For research use only. Not for therapeutic Use.
6-(Benzyloxy)-1H-indole-3-carbaldehyde(Cat No.:L037071)is an indole derivative featuring a benzyloxy group at the 6-position and an aldehyde group at the 3-position of the indole ring. The benzyloxy moiety introduces hydrophobicity and improves membrane permeability, while also serving as a removable protecting group. The aldehyde functionality enables key transformations such as condensation, reductive amination, or nucleophilic addition. This compound is widely used as an intermediate in the synthesis of pharmaceuticals, especially in the development of indole-based drugs targeting neurological, anti-inflammatory, or anticancer pathways due to its versatile reactivity and bioactive core.
| CAS Number | 92855-64-6 |
| Molecular Formula | C16H13NO2 |
| Purity | ≥95% |
| IUPAC Name | 6-phenylmethoxy-1H-indole-3-carbaldehyde |
| InChI | InChI=1S/C16H13NO2/c18-10-13-9-17-16-8-14(6-7-15(13)16)19-11-12-4-2-1-3-5-12/h1-10,17H,11H2 |
| InChIKey | UUKFCVCTRWNXBI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC3=C(C=C2)C(=CN3)C=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |