Home
>
Chemical Reagents>Heterocyclic Building Blocks> 6-Azaspiro[3.4]octane-8-carboxylic acid hydrochloride
For research use only. Not for therapeutic Use.
6-Azaspiro[3.4]octane-8-carboxylic acid hydrochloride(Cat No.:L007544), is a chemical compound featuring a unique spirocyclic structure with a carboxylic acid group at the 8th position and a hydrochloride salt form. This compound is significant in medicinal chemistry and drug development, often employed as a key scaffold in designing novel pharmaceutical agents. Its distinctive arrangement suggests potential pharmacological activities, making it valuable for further exploration in drug discovery.
| CAS Number | 1955554-31-0 |
| Molecular Formula | C8H14ClNO2 |
| Purity | ≥95% |
| IUPAC Name | 6-azaspiro[3.4]octane-8-carboxylic acid;hydrochloride |
| InChI | InChI=1S/C8H13NO2.ClH/c10-7(11)6-4-9-5-8(6)2-1-3-8;/h6,9H,1-5H2,(H,10,11);1H |
| InChIKey | UAPWGPOOTDEUGE-UHFFFAOYSA-N |
| SMILES | C1CC2(C1)CNCC2C(=O)O.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |