For research use only. Not for therapeutic Use.
6β-Chloro-17-acetoxy Progesterone is a synthetic steroid derived from progesterone, with a chlorine atom at the 6β position and an acetoxy group at the 17-position. This modification enhances its chemical stability and alters its biological activity, making it useful in hormone-related research and pharmaceutical development. It is often employed as an intermediate in the synthesis of various steroidal compounds, particularly for the development of progestins and corticosteroids. Researchers utilize 6β-Chloro-17-acetoxy Progesterone to study hormonal pathways and its potential applications in therapies related to reproductive health, inflammation, and other hormone-regulated conditions.
| CAS Number | 2658-74-4 |
| Synonyms | (6β)-17-(Acetyloxy)-6-chloropregn-4-ene-3,20-dione; 6β-Chloro-17-hydroxypregn-4-ene-3,20-dione Acetate; 6β-Chloro-17-hydroxyprogesterone Acetate; |
| Molecular Formula | C23H31ClO4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | [(6R,8R,9S,10R,13S,14S,17R)-17-acetyl-6-chloro-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
| InChI | InChI=1S/C23H31ClO4/c1-13(25)23(28-14(2)26)10-7-18-16-12-20(24)19-11-15(27)5-8-21(19,3)17(16)6-9-22(18,23)4/h11,16-18,20H,5-10,12H2,1-4H3/t16-,17+,18+,20-,21-,22+,23+/m1/s1 |
| InChIKey | DCVGANSDLNPXGO-LIASLNQGSA-N |
| SMILES | CC(=O)C1(CCC2C1(CCC3C2CC(C4=CC(=O)CCC34C)Cl)C)OC(=O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |