For research use only. Not for therapeutic Use.
(5S)-1-(Tert-butoxycarbonyl)-5-methyl-L-proline is a protected amino acid derivative used in peptide synthesis and pharmaceutical research. Featuring a tert-butoxycarbonyl (Boc) protecting group, this compound prevents unwanted reactions during peptide bond formation, facilitating the synthesis of complex peptides and proteins. Its chiral center at the 5th position, along with the methyl group, provides stereoselectivity in chemical reactions, making it valuable in drug discovery and the development of biologically active molecules in medicinal chemistry.
CAS Number | 334769-80-1 |
Molecular Formula | C11H19NO4 |
Purity | ≥95% |
IUPAC Name | (2S,5S)-5-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
InChI | InChI=1S/C11H19NO4/c1-7-5-6-8(9(13)14)12(7)10(15)16-11(2,3)4/h7-8H,5-6H2,1-4H3,(H,13,14)/t7-,8-/m0/s1 |
InChIKey | BSAYEGDCKUEPNE-YUMQZZPRSA-N |
SMILES | CC1CCC(N1C(=O)OC(C)(C)C)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |