For research use only. Not for therapeutic Use.
5MPN (Cat No.:I044378) is a selective inhibitor of 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase isoform 3 (PFKFB3), a key enzyme regulating glycolysis in cancer cells. By reducing levels of fructose-2,6-bisphosphate, 5MPN disrupts glycolytic flux, impairing energy production and biosynthesis in rapidly proliferating tumor cells. It shows antiproliferative effects in various cancer models, particularly those reliant on aerobic glycolysis (Warburg effect). As a metabolic inhibitor, 5MPN provides a valuable tool for studying cancer metabolism and supports therapeutic strategies targeting tumor bioenergetics, offering potential in oncology research focused on metabolic vulnerabilities.
| CAS Number | 47208-82-2 |
| Synonyms | 5-[(8-methoxyquinolin-4-yl)amino]pentyl nitrate |
| Molecular Formula | C15H19N3O4 |
| Purity | ≥95% |
| IUPAC Name | 5-[(8-methoxyquinolin-4-yl)amino]pentyl nitrate |
| InChI | InChI=1S/C15H19N3O4/c1-21-14-7-5-6-12-13(8-10-17-15(12)14)16-9-3-2-4-11-22-18(19)20/h5-8,10H,2-4,9,11H2,1H3,(H,16,17) |
| InChIKey | YBOILUNNGBGURC-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C(C=CN=C21)NCCCCCO[N+](=O)[O-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
