Home
>
Reference Standards> 5,7-Dihydroxy-8-(3-methyl-2-butenyl)-6-(2-methylpropanoyl)-4-phenyl-2H-1-benzopyran-2-one
For research use only. Not for therapeutic Use.
5,7-Dihydroxy-8-(3-methyl-2-butenyl)-6-(2-methylpropanoyl)-4-phenyl-2H-1-benzopyran-2-one(Cat No.:M080438) is a complex organic compound characterized by multiple functional groups and a diverse range of chemical properties. This molecule falls into the category of flavonoids, specifically a subtype known as flavones. It features a benzopyranone core structure substituted with hydroxyl groups, a phenyl group, and various side chains including a 3-methyl-2-butenyl group and a 2-methylpropanoyl group. Such a structure is indicative of a compound with potential antioxidant and biological activity, often explored for its therapeutic properties in pharmacology and medicinal chemistry.
| CAS Number | 16981-20-7 |
| Molecular Formula | C24H24O5 |
| Purity | ≥95% |
| Target | NF-κB |
| Storage | Store at RT |
| IUPAC Name | 5,7-dihydroxy-8-(3-methylbut-2-enyl)-6-(2-methylpropanoyl)-4-phenylchromen-2-one |
| InChI | InChI=1S/C24H24O5/c1-13(2)10-11-16-22(27)20(21(26)14(3)4)23(28)19-17(12-18(25)29-24(16)19)15-8-6-5-7-9-15/h5-10,12,14,27-28H,11H2,1-4H3 |
| InChIKey | IWUNXYBEJCJQHB-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)C1=C(C2=C(C(=C1O)CC=C(C)C)OC(=O)C=C2C3=CC=CC=C3)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |