Isosaponarin(Cat No.:M079786) is a naturally occurring flavonoid glycoside found in various plant species. It is characterized by its structure containing a glucose molecule attached to a flavone backbone. This compound exhibits significant antioxidant properties, contributing to plant defense against environmental stresses such as UV radiation and pathogen attack. In human health, isosaponarin has been studied for its potential anti-inflammatory, anticancer, and neuroprotective effects. Its ability to modulate oxidative stress and inflammation makes it a candidate for further research in pharmacological and nutraceutical applications, particularly in the prevention and management of chronic diseases.
Catalog Number | M079786 |
CAS Number | 19416-87-6 |
Molecular Formula | C27H30O15 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 5,7-dihydroxy-6-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-[4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]chromen-4-one |
InChI | InChI=1S/C27H30O15/c28-7-15-19(32)22(35)24(37)26(41-15)18-12(31)6-14-17(21(18)34)11(30)5-13(40-14)9-1-3-10(4-2-9)39-27-25(38)23(36)20(33)16(8-29)42-27/h1-6,15-16,19-20,22-29,31-38H,7-8H2/t15-,16-,19-,20-,22+,23+,24-,25-,26+,27-/m1/s1 |
InChIKey | SFNFQCXADNWOCI-KETMJRJWSA-N |
SMILES | C1=CC(=CC=C1C2=CC(=O)C3=C(O2)C=C(C(=C3O)C4C(C(C(C(O4)CO)O)O)O)O)OC5C(C(C(C(O5)CO)O)O)O |