For research use only. Not for therapeutic Use.
5,7-Dihydroxy-4-methylcoumarin (Cat No.:R072381) is a natural compound with promising potential in pharmaceutical research due to its diverse pharmacological activities. Acting as an antioxidant, it scavenges free radicals, offering cellular protection. Moreover, it exhibits anti-inflammatory effects by inhibiting pro-inflammatory cytokines. This compound also displays anticoagulant properties by affecting platelet aggregation. These attributes render 5,7-dihydroxy-4-methylcoumarin a valuable candidate for drug development, particularly in the fields of cardiovascular health and oxidative stress-related disorders.
| CAS Number | 2107-76-8 |
| Molecular Formula | C10H8O4 |
| Purity | ≥95% |
| Target | Fungal |
| IUPAC Name | 5,7-dihydroxy-4-methylchromen-2-one |
| InChI | InChI=1S/C10H8O4/c1-5-2-9(13)14-8-4-6(11)3-7(12)10(5)8/h2-4,11-12H,1H3 |
| InChIKey | QNVWGEJMXOQQPM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=CC(=CC(=C12)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |