For research use only. Not for therapeutic Use.
5,7-Dihydroxy-3,4′,8-trimethoxyflavone(CAT: M133890) is a naturally derived flavonoid compound characterized by its polyhydroxy and methoxy substitutions, contributing to its notable bioactivity and chemical stability. Found in various medicinal plants, this flavone exhibits a range of pharmacological effects, including anti-inflammatory, antioxidant, antiproliferative, and neuroprotective properties. Its unique substitution pattern enhances membrane permeability and interaction with biological targets, making it valuable in natural product research and drug discovery. The compound is often explored for its potential in treating chronic diseases such as cancer, cardiovascular disorders, and neurodegeneration. It also serves as a useful reference standard in phytochemical and SAR studies.
| CAS Number | 1570-09-8 |
| Synonyms | 5,7-dihydroxy-3,8-dimethoxy-2-(4-methoxyphenyl)chromen-4-one |
| Molecular Formula | C18H16O7 |
| Purity | ≥95% |
| IUPAC Name | 5,7-dihydroxy-3,8-dimethoxy-2-(4-methoxyphenyl)chromen-4-one |
| InChI | InChI=1S/C18H16O7/c1-22-10-6-4-9(5-7-10)15-18(24-3)14(21)13-11(19)8-12(20)16(23-2)17(13)25-15/h4-8,19-20H,1-3H3 |
| InChIKey | RXQVMRRNRHSOTC-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(C(=O)C3=C(O2)C(=C(C=C3O)O)OC)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
