For research use only. Not for therapeutic Use.
5,7-Dichloroimidazo[1,2-c]pyrimidine(Cat No.:L033887)is a heterocyclic compound featuring chlorine atoms at the 5- and 7-positions on an imidazo[1,2-c]pyrimidine ring. This structure is particularly significant in pharmaceutical chemistry, where it serves as a core scaffold for developing bioactive molecules, including antiviral, anticancer, and anti-inflammatory agents. The dichloro substitution enhances the compound’s reactivity, allowing for selective functionalization and derivatization. This compound is crucial in medicinal chemistry for synthesizing drugs that target specific biological pathways, contributing to the development of novel therapeutic agents.
| CAS Number | 85989-61-3 |
| Molecular Formula | C6H3Cl2N3 |
| Purity | ≥95% |
| IUPAC Name | 5,7-dichloroimidazo[1,2-c]pyrimidine |
| InChI | InChI=1S/C6H3Cl2N3/c7-4-3-5-9-1-2-11(5)6(8)10-4/h1-3H |
| InChIKey | QMTXTHVMSRFISO-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=N1)C=C(N=C2Cl)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |