For research use only. Not for therapeutic Use.
5,6,7,8-Tetrahydro-[1,7]naphthyridine (Cat.No:M061910) is a chemical compound with a bicyclic structure. It has versatile applications in organic synthesis, particularly in the preparation of complex molecules and heterocyclic compounds. Its unique ring system makes it valuable in medicinal chemistry and the development of various chemical products.
CAS Number | 13623-85-3 |
Molecular Formula | C8H10N2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 5,6,7,8-tetrahydro-1,7-naphthyridine |
InChI | InChI=1S/C8H10N2/c1-2-7-3-5-9-6-8(7)10-4-1/h1-2,4,9H,3,5-6H2 |
InChIKey | SRQJSMFCZYZSLB-UHFFFAOYSA-N |
SMILES | C1CNCC2=C1C=CC=N2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |