For research use only. Not for therapeutic Use.
5,6-Dibromo-1H-benzo[d]imidazole(CAT: L037268) is a valuable brominated compound widely used in pharmaceutical research and organic synthesis. Featuring two bromine atoms on the benzimidazole core, it serves as a precursor in the synthesis of biologically active molecules and heterocyclic compounds. This compound is highly sought after for developing inhibitors, antitumor agents, and other bioactive compounds, owing to the benzimidazole’s versatility in pharmacophores. With its stable structure, 5,6-Dibromo-1H-benzo[d]imidazole facilitates reliable reactions, making it essential for advanced chemical and medicinal research applications.A
| CAS Number | 74545-26-9 |
| Molecular Formula | C7H4Br2N2 |
| Purity | ≥95% |
| IUPAC Name | 5,6-dibromo-1H-benzimidazole |
| InChI | InChI=1S/C7H4Br2N2/c8-4-1-6-7(2-5(4)9)11-3-10-6/h1-3H,(H,10,11) |
| InChIKey | MJVDZXWFJQYHIU-UHFFFAOYSA-N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |