5,5'-Divinyl-2,2'-bipyridine - CAS 932396-96-8

5,5′-Divinyl-2,2′-bipyridine (Cat.No:L003605) is a pivotal compound in organic synthesis. Its unique structure, featuring two vinyl groups on a bipyridine backbone, imparts distinctive reactivity. This makes it a valuable building block in the creation of specialized materials, particularly in the field of coordination chemistry and supramolecular assemblies. Its significance lies in its role as a versatile precursor for the synthesis of functionalized molecules with a range of applications in materials science.

Catalog Number: L003605

CAS Number: 932396-96-8

Molecular Formula: C14H12N2

Molecular Weight:208.26

Purity: ≥95%

* For research use only. Not for human or veterinary use.


Property

Molecular Formula: C14H12N2
Molecular Weight208.26
Purity≥95%

Computed Descriptor

IUPAC Name5-ethenyl-2-(5-ethenylpyridin-2-yl)pyridine
InChIInChI=1S/C14H12N2/c1-3-11-5-7-13(15-9-11)14-8-6-12(4-2)10-16-14/h3-10H,1-2H2
InChIKeyRLSLVUNCQSJTCV-UHFFFAOYSA-N
SMILESC=CC1=CN=C(C=C1)C2=NC=C(C=C2)C=C