For research use only. Not for therapeutic Use.
5-Vinylisophthalic acid(Cat No.:L007159), is a chemical compound. It features a vinyl group (CH2=CH-) attached to an isophthalic acid core—a benzene ring with carboxylic acid groups at the 1st and 3rd positions. This compound is essential in polymer chemistry, serving as a valuable monomer for the synthesis of specialty polymers, particularly in the development of high-performance materials like resins and coatings. Its unique structure contributes to the creation of polymers with enhanced mechanical and thermal properties, making it significant in various industrial applications and research related to advanced materials.
| CAS Number | 1041374-16-6 |
| Molecular Formula | C10H8O4 |
| Purity | ≥95% |
| IUPAC Name | 5-ethenylbenzene-1,3-dicarboxylic acid |
| InChI | InChI=1S/C10H8O4/c1-2-6-3-7(9(11)12)5-8(4-6)10(13)14/h2-5H,1H2,(H,11,12)(H,13,14) |
| InChIKey | RFRNGRYAJCOIAN-UHFFFAOYSA-N |
| SMILES | C=CC1=CC(=CC(=C1)C(=O)O)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |