For research use only. Not for therapeutic Use.
5-(Trifluoromethyl)uracil（Cat No.:L013779）is a fluorinated pyrimidine derivative featuring a trifluoromethyl group (–CF₃) at the 5-position of the uracil ring. This modification significantly enhances the molecule’s lipophilicity, metabolic stability, and electron-withdrawing properties, making it a valuable compound in medicinal chemistry and nucleic acid research. It serves as a structural analog of uracil, potentially interfering with nucleic acid synthesis, and has been explored for antiviral and anticancer activity. Its altered electronic profile makes it useful in designing fluorinated nucleoside analogs and biochemical probes for studying enzyme–substrate interactions involving pyrimidine metabolism.
| CAS Number | 54-20-6 |
| Molecular Formula | C5H3F3N2O2 |
| Purity | ≥95% |
| IUPAC Name | 5-(trifluoromethyl)-1H-pyrimidine-2,4-dione |
| InChI | InChI=1S/C5H3F3N2O2/c6-5(7,8)2-1-9-4(12)10-3(2)11/h1H,(H2,9,10,11,12) |
| InChIKey | LMNPKIOZMGYQIU-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC(=O)N1)C(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
