(5-Phenyl-1H-indol-3-yl)acetic acid(CAT: L000282) is a compound with applications in pharmaceutical and organic chemistry. This molecule is used as an important intermediate in the synthesis of pharmaceutical compounds. Its action method involves serving as a key structural component in the development of drug candidates, making it pivotal in the field of drug discovery and development.
Catalog Number | L000282 |
CAS Number | 168649-23-8 |
Molecular Formula | C16H13NO2 |
Purity | 95% |
IUPAC Name | 2-(5-phenyl-1H-indol-3-yl)acetic acid |
InChI | InChI=1S/C16H13NO2/c18-16(19)9-13-10-17-15-7-6-12(8-14(13)15)11-4-2-1-3-5-11/h1-8,10,17H,9H2,(H,18,19) |
InChIKey | ACCCWYHBDGKDKN-UHFFFAOYSA-N |