For research use only. Not for therapeutic Use.
5′-O-TBDMS-N4-Benzoyl-2′-deoxycytidine（Cat No.:I044609）is a protected deoxyribonucleoside phosphoramidite derived from 2′-deoxycytidine, featuring a 5′-O-tert-butyldimethylsilyl (TBDMS) group on the 5′-hydroxyl and a benzoyl (Bz) group on the N4 exocyclic amino group. These protecting groups provide enhanced chemical stability and enable selective deprotection, especially useful in complex or orthogonal oligonucleotide synthesis. The TBDMS group is typically removed using fluoride-based reagents, allowing precise control during synthesis. This compound is used in constructing modified DNA strands for applications in gene regulation research, diagnostics, and nucleic acid-based therapeutics, where protection strategy and sequence fidelity are critical.
| CAS Number | 51549-36-1 |
| Synonyms | N-[1-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
| Molecular Formula | C22H31N3O5Si |
| Purity | ≥95% |
| IUPAC Name | N-[1-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
| InChI | InChI=1S/C22H31N3O5Si/c1-22(2,3)31(4,5)29-14-17-16(26)13-19(30-17)25-12-11-18(24-21(25)28)23-20(27)15-9-7-6-8-10-15/h6-12,16-17,19,26H,13-14H2,1-5H3,(H,23,24,27,28)/t16-,17+,19+/m0/s1 |
| InChIKey | CCPOWNJNXQQIFV-YQVWRLOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1[C@H](C[C@@H](O1)N2C=CC(=NC2=O)NC(=O)C3=CC=CC=C3)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
