For research use only. Not for therapeutic Use.
5′-O-TBDMS-dG（Cat No.:I044605）is a deoxyribonucleoside phosphoramidite derived from deoxyguanosine (dG), featuring a 5′-O-tert-butyldimethylsilyl (TBDMS) group that protects the 5′-hydroxyl during synthesis. This bulky silyl protection offers enhanced stability under basic and acidic conditions, making it ideal for complex oligonucleotide synthesis requiring selective deprotection steps. Typically removed with fluoride ions, TBDMS ensures compatibility with orthogonal protection schemes. 5′-O-TBDMS-dG is used in constructing chemically modified or chimeric DNA strands for research in structural biology, nucleic acid therapeutics, and diagnostic probe design where robust and selective protection strategies are critical.
| CAS Number | 51549-33-8 |
| Synonyms | 2-amino-9-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-1H-purin-6-one |
| Molecular Formula | C16H27N5O4Si |
| Purity | ≥95% |
| IUPAC Name | 2-amino-9-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-1H-purin-6-one |
| InChI | InChI=1S/C16H27N5O4Si/c1-16(2,3)26(4,5)24-7-10-9(22)6-11(25-10)21-8-18-12-13(21)19-15(17)20-14(12)23/h8-11,22H,6-7H2,1-5H3,(H3,17,19,20,23)/t9-,10+,11+/m0/s1 |
| InChIKey | SEYILVDPIQPEAP-HBNTYKKESA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1[C@H](C[C@@H](O1)N2C=NC3=C2N=C(NC3=O)N)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
