For research use only. Not for therapeutic Use.
5′-O-TBDMS-dA（Cat No.:I044604）is a protected deoxyribonucleoside phosphoramidite based on deoxyadenosine (dA), featuring a 5′-O-tert-butyldimethylsilyl (TBDMS) group that protects the 5′-hydroxyl function. The TBDMS group provides robust protection during RNA or DNA synthesis under harsh conditions and is typically removed with fluoride-based reagents. This modification is especially useful in synthetic protocols requiring orthogonal protection strategies or selective deprotection steps. 5′-O-TBDMS-dA supports the synthesis of complex oligonucleotides, including chimeric constructs and modified backbones, used in therapeutic development, structural studies, and advanced nucleic acid research applications.
| CAS Number | 51549-30-5 |
| Synonyms | (2R,3S,5R)-5-(6-aminopurin-9-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-3-ol |
| Molecular Formula | C16H27N5O3Si |
| Purity | ≥95% |
| IUPAC Name | (2R,3S,5R)-5-(6-aminopurin-9-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-3-ol |
| InChI | InChI=1S/C16H27N5O3Si/c1-16(2,3)25(4,5)23-7-11-10(22)6-12(24-11)21-9-20-13-14(17)18-8-19-15(13)21/h8-12,22H,6-7H2,1-5H3,(H2,17,18,19)/t10-,11+,12+/m0/s1 |
| InChIKey | HGLRBQHXIBHZTD-QJPTWQEYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1[C@H](C[C@@H](O1)N2C=NC3=C(N=CN=C32)N)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
