For research use only. Not for therapeutic Use.
<p>
<span style="color:#000000;"><span style="font-size:12px;"><span style="font-family:arial,helvetica,sans-serif;">5-O-Feruloylquinic acid (CAS 40242-06-6) is a derivative of quinic acid and a constituent of coffee beans. Studies showed that coffee polyphenols is able to suppress fat accumulation by downregulating SREBP-1c in mice.</span></span></span></p>
| CAS Number | 40242-06-6 |
| Molecular Formula | C17H20O9 |
| Purity | 98% |
| Target | Tyrosinase |
| Appearance | Powder |
| IUPAC Name | (1R,3R,4S,5R)-1,3,4-trihydroxy-5-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxycyclohexane-1-carboxylic acid |
| InChI | InChI=1S/C17H20O9/c1-25-12-6-9(2-4-10(12)18)3-5-14(20)26-13-8-17(24,16(22)23)7-11(19)15(13)21/h2-6,11,13,15,18-19,21,24H,7-8H2,1H3,(H,22,23)/b5-3+/t11-,13-,15+,17-/m1/s1 |
| InChIKey | RAGZUCNPTLULOL-KQJPBSFVSA-N |
| SMILES | COC1=C(C=CC(=C1)C=CC(=O)OC2CC(CC(C2O)O)(C(=O)O)O)O |
| Reference | <p> |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |