For research use only. Not for therapeutic Use.
5′-O-DMT-PAC-dA（Cat No.:M013014）is a deoxyribonucleoside phosphoramidite based on deoxyadenosine (dA), protected with a 5′-O-dimethoxytrityl (DMT) group at the 5′-hydroxyl and a phenoxyacetyl (PAC) group on the exocyclic amino function. These protecting groups enable selective reactivity and stability during automated DNA synthesis, ensuring high coupling efficiency and minimal side reactions. The PAC group offers mild deprotection conditions, making it suitable for sensitive applications. 5′-O-DMT-PAC-dA is widely used in the synthesis of high-fidelity DNA oligonucleotides for molecular biology, diagnostics, and therapeutic development, where precision and purity are critical.
| CAS Number | 110522-82-2 |
| Synonyms | N-[9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]purin-6-yl]-2-phenoxyacetamide |
| Molecular Formula | C39H37N5O7 |
| Purity | ≥95% |
| IUPAC Name | N-[9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]purin-6-yl]-2-phenoxyacetamide |
| InChI | InChI=1S/C39H37N5O7/c1-47-29-17-13-27(14-18-29)39(26-9-5-3-6-10-26,28-15-19-30(48-2)20-16-28)50-22-33-32(45)21-35(51-33)44-25-42-36-37(40-24-41-38(36)44)43-34(46)23-49-31-11-7-4-8-12-31/h3-20,24-25,32-33,35,45H,21-23H2,1-2H3,(H,40,41,43,46)/t32-,33+,35+/m0/s1 |
| InChIKey | JDJUQANHKJNEFT-VUHKNJSWSA-N |
| SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)OC[C@@H]4[C@H](C[C@@H](O4)N5C=NC6=C(N=CN=C65)NC(=O)COC7=CC=CC=C7)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
