For research use only. Not for therapeutic Use.
5′-O-DMT-2′-O-TBDMS-Bz-rC(Cat No.:R072790)is a protected ribonucleoside derivative of cytidine, commonly used in the solid-phase chemical synthesis of RNA oligonucleotides. It features a 5′-O-dimethoxytrityl (DMT) group protecting the 5′-hydroxyl, a 2′-O-tert-butyldimethylsilyl (TBDMS) group shielding the 2′-hydroxyl, and a benzoyl (Bz) group protecting the exocyclic amine on the cytosine base. These protective groups enable site-specific reactions and prevent undesired side reactions during automated RNA synthesis. 5′-O-DMT-2′-O-TBDMS-Bz-rC is essential for generating high-purity RNA strands used in therapeutic development, biochemical research, and studies of RNA structure and function.
| CAS Number | 81256-87-3 |
| Synonyms | N-[1-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
| Molecular Formula | C43H49N3O8Si |
| Purity | ≥95% |
| IUPAC Name | N-[1-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
| InChI | InChI=1S/C43H49N3O8Si/c1-42(2,3)55(6,7)54-38-37(47)35(53-40(38)46-27-26-36(45-41(46)49)44-39(48)29-14-10-8-11-15-29)28-52-43(30-16-12-9-13-17-30,31-18-22-33(50-4)23-19-31)32-20-24-34(51-5)25-21-32/h8-27,35,37-38,40,47H,28H2,1-7H3,(H,44,45,48,49)/t35-,37-,38-,40-/m1/s1 |
| InChIKey | AOXWVTIMEGOVNF-PKGPUZNISA-N |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H]([C@H](O[C@H]1N2C=CC(=NC2=O)NC(=O)C3=CC=CC=C3)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |