For research use only. Not for therapeutic Use.
5-O-Benzyl-2,3-O-isopropylidene-D-ribono-1,4-lactone is a protected ribonolactone derivative used in organic synthesis. Its stable, masked functional groups make it a valuable intermediate for developing nucleosides and complex organic molecules. This compound is essential in pharmaceutical and biochemical research, facilitating the synthesis of various drugs and aiding in the study of carbohydrate chemistry and metabolism.
| CAS Number | 85846-80-6 |
| Synonyms | 2,3-O-(1-Methylethylidene)-5-O-(phenylmethyl)-D-ribonic Acid γ-Lactone; 5-O-Benzyl-2,3-O-Isopropylideneribonic Acid γ-Lactone; Furo[3,4-d]-1,3-dioxole D-Ribonic Acid Deriv.; (6R)-6-((Benzyloxy)methyl)-2,2-dimethyldihydrofuro[3,4-d][1,3]dioxol-4(3aH)- |
| Molecular Formula | C15H18O5 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (3aR,6R,6aR)-2,2-dimethyl-6-(phenylmethoxymethyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one |
| InChI | InChI=1S/C15H18O5/c1-15(2)19-12-11(18-14(16)13(12)20-15)9-17-8-10-6-4-3-5-7-10/h3-7,11-13H,8-9H2,1-2H3/t11-,12-,13-/m1/s1 |
| InChIKey | HTBWOOVHGLNZBX-JHJVBQTASA-N |
| SMILES | CC1(OC2C(OC(=O)C2O1)COCC3=CC=CC=C3)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |