For research use only. Not for therapeutic Use.
5-Norbornene-2-ol(Cat No.:M058911)is a bicyclic compound featuring an alcohol group on the norbornene framework. It is widely used in organic synthesis and polymer chemistry due to its strained ring structure, which makes it highly reactive and suitable for a variety of chemical transformations, including ring-opening metathesis polymerization (ROMP). This compound serves as a key intermediate in the development of specialty polymers, adhesives, and coatings. Its unique structure also makes it valuable in pharmaceutical research for synthesizing bioactive molecules. High purity ensures reliable performance in advanced research and industrial applications.
CAS Number | 13080-90-5 |
Molecular Formula | C7H10O |
Purity | ≥95% |
Storage | -80°C |
IUPAC Name | bicyclo[2.2.1]hept-5-en-2-ol |
InChI | InChI=1S/C7H10O/c8-7-4-5-1-2-6(7)3-5/h1-2,5-8H,3-4H2 |
InChIKey | MKOSBHNWXFSHSW-UHFFFAOYSA-N |
SMILES | C1C2CC(C1C=C2)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |