For research use only. Not for therapeutic Use.
5-nitrobenzo[c][1,2]oxaborol-1(3H)-ol (Cat.No:L003675) is a pivotal chemical compound with versatile applications in medicinal chemistry. Its distinctive structure, incorporating a boron-containing oxaborole ring, imparts unique pharmacological properties. This compound serves as a crucial scaffold in the development of pharmaceutical agents, particularly in the quest for novel antifungal and antibacterial compounds.
| CAS Number | 875816-94-7 |
| Molecular Formula | C7H6BNO4 |
| Purity | ≥95% |
| IUPAC Name | 1-hydroxy-5-nitro-3H-2,1-benzoxaborole |
| InChI | InChI=1S/C7H6BNO4/c10-8-7-2-1-6(9(11)12)3-5(7)4-13-8/h1-3,10H,4H2 |
| InChIKey | VHUKHRCRSXJPFF-UHFFFAOYSA-N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |