For research use only. Not for therapeutic Use.
5-Methylbenzo[d]oxazole-2-carboxylic acid(Cat No.:L007422), is a heterocyclic compound with the molecular formula C9H7NO3. This compound belongs to the class of organic compounds known as benzoxazoles, which are aromatic compounds containing a benzene ring fused to an oxazole ring. Benzoxazoles have diverse biological activities and find applications in medicinal chemistry and pharmaceutical research. The presence of a carboxylic acid group in this compound suggests potential applications in synthesis, especially as a building block for more complex molecules.
| CAS Number | 49559-66-2 |
| Molecular Formula | C9H7NO3 |
| Purity | ≥95% |
| IUPAC Name | 5-methyl-1,3-benzoxazole-2-carboxylic acid |
| InChI | InChI=1S/C9H7NO3/c1-5-2-3-7-6(4-5)10-8(13-7)9(11)12/h2-4H,1H3,(H,11,12) |
| InChIKey | XAQPBOKLRYZEMF-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)OC(=N2)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |