Home
>
Chemical Reagents>Heterocyclic Building Blocks> (5-Methyl-1,2,4-oxadiazol-3-yl)methanamine hydrochloride
For research use only. Not for therapeutic Use.
(5-Methyl-1,2,4-oxadiazol-3-yl)methanamine hydrochloride(Cat No.:L027236)is a versatile heterocyclic compound used in pharmaceutical and chemical research. This compound features a 1,2,4-oxadiazole ring with a methyl group at the 5-position and a methanamine group, making it a valuable intermediate in the synthesis of bioactive molecules and drug candidates. The hydrochloride salt form enhances its solubility and stability, facilitating its use in various chemical reactions. Its structure allows for diverse functionalization, making it important in the development of new therapeutic agents and advanced materials.
CAS Number | 1184986-84-2 |
Molecular Formula | C4H8ClN3O |
Purity | ≥95% |
IUPAC Name | (5-methyl-1,2,4-oxadiazol-3-yl)methanamine;hydrochloride |
InChI | InChI=1S/C4H7N3O.ClH/c1-3-6-4(2-5)7-8-3;/h2,5H2,1H3;1H |
InChIKey | PMGNTVSNOHHGFJ-UHFFFAOYSA-N |
SMILES | CC1=NC(=NO1)CN.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |