For research use only. Not for therapeutic Use.
[5-Methyl-1-(oxan-2-yl)-1H-indazol-4-yl]boronic acid(Cat No.:L007189), is a chemical compound. It contains an indazole ring—a bicyclic structure—substituted with a boronic acid group at the 4th position, a methyl group at the 5th position, and an oxan-2-yl group at the 1st position. This compound is significant in organic synthesis, particularly in Suzuki-Miyaura coupling reactions. Its boronic acid group enables it to react with aryl halides or triflates, allowing the construction of complex organic molecules. Researchers utilize [5-Methyl-1-(oxan-2-yl)-1H-indazol-4-yl]boronic acid for the synthesis of various functionalized indazole derivatives, contributing to advancements in chemical research and drug discovery.
CAS Number | 2022976-34-5 |
Molecular Formula | C13H17BN2O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | [5-methyl-1-(oxan-2-yl)indazol-4-yl]boronic acid |
InChI | InChI=1S/C13H17BN2O3/c1-9-5-6-11-10(13(9)14(17)18)8-15-16(11)12-4-2-3-7-19-12/h5-6,8,12,17-18H,2-4,7H2,1H3 |
InChIKey | NZYJBZOXEHVCHI-UHFFFAOYSA-N |
SMILES | B(C1=C(C=CC2=C1C=NN2C3CCCCO3)C)(O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |