For research use only. Not for therapeutic Use.
5-Methoxyindole (Cat No.: R002433) is a naturally occurring indole derivative featuring a methoxy group at the 5-position of the indole ring. It serves as a key intermediate in the synthesis of pharmacologically active compounds, including serotonin analogs and melatonin derivatives. Known for its role in neurotransmitter and hormone pathways, it is widely used in biochemical and pharmaceutical research. Its electron-rich structure makes it reactive in electrophilic substitution reactions, enabling diverse chemical modifications for drug discovery and development applications.
| CAS Number | 1006-94-6 |
| Synonyms | Indol-5-yl Methyl Ether; 5-Methoxy-1H-indole; NSC 521752; |
| Molecular Formula | C9H9NO |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 5-methoxy-1H-indole |
| InChI | InChI=1S/C9H9NO/c1-11-8-2-3-9-7(6-8)4-5-10-9/h2-6,10H,1H3 |
| InChIKey | DWAQDRSOVMLGRQ-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)NC=C2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
