5-Methanesulfonylfuran-2-carboxylic acid(Cat No.:L007475), is a chemical compound with significance in organic synthesis and pharmaceutical research. Its unique structure, containing both a furan ring and a sulfonyl group, renders it valuable for the development of new molecules and materials. Researchers explore its reactivity and properties to understand its behavior in various chemical reactions, contributing to the advancement of synthetic methodologies. Additionally, its potential biological activities make it a subject of interest in medicinal chemistry, where scientists investigate its derivatives for drug discovery and development purposes, aiming to create novel pharmaceutical agents.
Catalog Number | L007475 |
CAS Number | 23423-91-8 |
Molecular Formula | C6H6O5S |
Purity | 95% |
IUPAC Name | 5-methylsulfonylfuran-2-carboxylic acid |
InChI | InChI=1S/C6H6O5S/c1-12(9,10)5-3-2-4(11-5)6(7)8/h2-3H,1H3,(H,7,8) |
InChIKey | ZREDSSGHFVMCQP-UHFFFAOYSA-N |
SMILES | CS(=O)(=O)C1=CC=C(O1)C(=O)O |