5-<wbr></wbr>MAPB is an amino-<wbr></wbr>methylated derivative of 5-<wbr></wbr>APB (Item No. <span class=/itemid/>11134</span>), an amphetamine-<wbr></wbr>like designer drug. The physiological and toxicological properties of this compound have not been evaluated. This product is intended for forensic and research purposes.
| Catalog Number | R064667 |
| CAS Number | 1823925-53-6 |
| Synonyms | 5-(2-Methylaminopropyl)Benzofuran |
| Molecular Formula | C12H15NO • HCl |
| Purity | 95% |
| Storage | -20°C |
| InChI | InChI=1S/C12H15NO.ClH/c1-9(13-2)7-10-3-4-12-11(8-10)5-6-14-12;/h3-6,8-9,13H,7H2,1-2H3;1H |
| InChIKey | KDOMNGVEAOZFQY-UHFFFAOYSA-N |
| SMILES | CC(NC)CC1=CC(C=CO2)=C2C=C1.Cl |
