For research use only. Not for therapeutic Use.
5-LOX-IN-1（Cat No.:I042881）is a potent inhibitor of 5-lipoxygenase (5-LOX), an enzyme involved in the biosynthesis of leukotrienes, which are inflammatory mediators implicated in various diseases such as asthma, rheumatoid arthritis, and cardiovascular disorders. By inhibiting 5-LOX, 5-LOX-IN-1 helps reduce the production of leukotrienes, thus modulating the inflammatory response. This compound holds therapeutic potential in treating conditions characterized by excessive inflammation. Its selectivity for 5-LOX makes it a valuable tool in research aimed at understanding the role of leukotrienes in inflammatory diseases and exploring targeted treatments.
| CAS Number | 55040-82-9 |
| Synonyms | (2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)-phenylmethanone |
| Molecular Formula | C20H18N2O2S |
| Purity | ≥95% |
| IUPAC Name | (2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)-phenylmethanone |
| InChI | InChI=1S/C20H18N2O2S/c23-18(16-9-5-2-6-10-16)19-17(15-7-3-1-4-8-15)21-20(25-19)22-11-13-24-14-12-22/h1-10H,11-14H2 |
| InChIKey | LHLMRDAASBJJEP-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=NC(=C(S2)C(=O)C3=CC=CC=C3)C4=CC=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
