For research use only. Not for therapeutic Use.
5-Hydroxytryptamine(Cat No.:M002550), often referred to as serotonin. It is a neurotransmitter and hormone found in animals and humans, playing a crucial role in various physiological processes. Serotonin contributes to mood regulation, appetite control, and sleep patterns. It is synthesized from tryptophan and is involved in transmitting signals between nerve cells. Dysregulation of serotonin levels is associated with mood disorders, such as depression and anxiety. Serotonin is also linked to gastrointestinal function, cardiovascular health, and other physiological functions, making it a key molecule in understanding both neurological and systemic processes in the body.
| CAS Number | 50-67-9 |
| Synonyms | 3-(2-AMINOETHYL)INDOL-5-OL;3-(2-AMINOETHYL)-5-HYDROXYINDOLE;3-(2-AMINO-ETHYL)-1H-INDOL-5-OL;5-HYDROXYTRYPTAMINE;AURORA KA-7815;3-(2-aminoethyl)-indol-5-o;3-(beta-aminoethyl)-5-hydroxyindole;5-hta; serotonin |
| Molecular Formula | C10H12N2O |
| Purity | ≥95% |
| Storage | 2-8°C |
| IUPAC Name | 3-(2-aminoethyl)-1H-indol-5-ol |
| InChI | InChI=1S/C10H12N2O/c11-4-3-7-6-12-10-2-1-8(13)5-9(7)10/h1-2,5-6,12-13H,3-4,11H2 |
| InChIKey | QZAYGJVTTNCVMB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)C(=CN2)CCN |
| Reference | 1: Volpi-Abadie J, Kaye AM, Kaye AD. Serotonin syndrome. Ochsner J. 2013 Winter;13(4):533-40. Review. PubMed PMID: 24358002; PubMed Central PMCID: PMC3865832.<br /> |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |