For research use only. Not for therapeutic Use.
5-(Hydroxymethyl)cytidine(Cat No.:R020937)is a modified nucleoside derivative of cytidine, where the hydroxymethyl group is attached to the 5-position of the pyrimidine ring. It is an important intermediate in DNA and RNA modifications, playing a role in epigenetic regulation. The compound is involved in the process of DNA hydroxymethylation, a modification that can influence gene expression and cell differentiation. 5-(Hydroxymethyl)cytidine is also being studied for its potential implications in cancer research, neurobiology, and other diseases, as changes in DNA hydroxymethylation patterns are linked to various pathological conditions.
| CAS Number | 19235-17-7 |
| Synonyms | 4-amino-1-[(2R,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(hydroxymethyl)pyrimidin-2-one |
| Molecular Formula | C10H15N3O6 |
| Purity | ≥95% |
| IUPAC Name | 4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(hydroxymethyl)pyrimidin-2-one |
| InChI | InChI=1S/C10H15N3O6/c11-8-4(2-14)1-13(10(18)12-8)9-7(17)6(16)5(3-15)19-9/h1,5-7,9,14-17H,2-3H2,(H2,11,12,18)/t5-,6-,7-,9-/m1/s1 |
| InChIKey | NFEXJLMYXXIWPI-JXOAFFINSA-N |
| SMILES | C1=C(C(=NC(=O)N1[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O)N)CO |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |