Home
>
Chemical Reagents>Organic Building Blocks>Buliding Block Chemicals> 5-Hydroxy-4-oxo-1,4-dihydropyridine-2-carboxylic acid
For research use only. Not for therapeutic Use.
5-Hydroxy-4-oxo-1,4-dihydropyridine-2-carboxylic acid(CAT: L043120) is a multifunctional heterocyclic compound featuring a hydroxyl, keto, and carboxylic acid group on a dihydropyridine core. This molecule serves as a key intermediate in the synthesis of bioactive heterocycles and pharmaceutical agents, particularly those targeting oxidative stress, inflammation, or neurological pathways. The presence of both hydrogen bond donors and acceptors makes it highly versatile in drug design and molecular docking applications. It also functions as a scaffold in developing enzyme inhibitors and chelating agents.
| CAS Number | 43077-77-6 |
| Molecular Formula | C6H5NO4 |
| Purity | ≥95% |
| IUPAC Name | 5-hydroxy-4-oxo-1H-pyridine-2-carboxylic acid |
| InChI | InChI=1S/C6H5NO4/c8-4-1-3(6(10)11)7-2-5(4)9/h1-2,9H,(H,7,8)(H,10,11) |
| InChIKey | GMYHFMYEZAGTBN-UHFFFAOYSA-N |
| SMILES | C1=C(NC=C(C1=O)O)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |