For research use only. Not for therapeutic Use.
5-Hydroxy-2-iodophenylboronic acid pinacol ester(Cat No.:M032389) is a specialized chemical compound used primarily in organic synthesis. It combines a boronic acid group, beneficial for Suzuki coupling reactions—a type of cross-coupling reaction that forms biaryl compounds—with a protective pinacol ester group. The presence of an iodine atom at the 2-position and a hydroxyl group at the 5-position on the aromatic ring enhances its reactivity and offers diverse functionalization opportunities. This compound is crucial in pharmaceutical and materials science research for constructing complex molecular architectures, particularly in the synthesis of biologically active molecules and new materials.
| CAS Number | 1256781-71-1 |
| Synonyms | 5-Hydroxy-2-iodophenylboronic acid pinacol ester |
| Molecular Formula | C12H16BIO3 |
| Purity | ≥95% |
| Storage | Store at +4C |
| IUPAC Name | 4-iodo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| InChI | InChI=1S/C12H16BIO3/c1-11(2)12(3,4)17-13(16-11)9-7-8(15)5-6-10(9)14/h5-7,15H,1-4H3 |
| InChIKey | QLZQKMXNNCBLSI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)O)I |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |