For research use only. Not for therapeutic Use.
| CAS Number | 24985-85-1 |
| Synonyms | 5-Hydroxyindole-2-carboxylic acid Ethyl Ester; Ethyl 5-hydroxy-1H-indole-2-carboxylate; Ethyl 5-Hydroxyindole-2-carboxylate |
| Molecular Formula | C11H11NO3 |
| Purity | ≥95% |
| Storage | Desiccate at RT |
| IUPAC Name | ethyl 5-hydroxy-1H-indole-2-carboxylate |
| InChI | InChI=1S/C11H11NO3/c1-2-15-11(14)10-6-7-5-8(13)3-4-9(7)12-10/h3-6,12-13H,2H2,1H3 |
| InChIKey | WANAXLMRGYGCPC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(N1)C=CC(=C2)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |