For research use only. Not for therapeutic Use.
5-Hexen-2-ol(Cat No.:L007124), is a chemical compound with the molecular formula C6H12O. Also known as leaf alcohol or pent-4-en-1-ol, it is an unsaturated alcohol with a six-carbon chain and a double bond at the 5th carbon position. This compound occurs naturally in various plants and contributes to their aroma. It is widely used in the flavor and fragrance industry due to its pleasant, green, and grassy odor. Additionally, 5-Hexen-2-ol finds applications in organic synthesis, acting as a versatile intermediate for the production of diverse chemicals and pharmaceutical compounds.
CAS Number | 626-94-8 |
Molecular Formula | C6H12O |
Purity | ≥95% |
IUPAC Name | hex-5-en-2-ol |
InChI | InChI=1S/C6H12O/c1-3-4-5-6(2)7/h3,6-7H,1,4-5H2,2H3 |
InChIKey | LNPNXWKVAFKIBX-UHFFFAOYSA-N |
SMILES | CC(CCC=C)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |