For research use only. Not for therapeutic Use.
5-Fluoroquinolin-7-ol(Cat No.:L002215)is a fluorinated heterocyclic compound widely used in pharmaceutical and chemical research. Featuring a fluorine atom at the 5-position and a hydroxyl group at the 7-position on the quinoline ring, this compound serves as a valuable intermediate in the synthesis of bioactive molecules, including potential drug candidates. Its unique structure allows for various chemical modifications, making it essential in the development of complex organic compounds. 5-Fluoroquinolin-7-ol is particularly useful for researchers focused on advancing medicinal chemistry and exploring novel therapeutic agents.
| CAS Number | 1261771-12-3 |
| Molecular Formula | C9H6FNO |
| Purity | ≥95% |
| IUPAC Name | 5-fluoroquinolin-7-ol |
| InChI | InChI=1S/C9H6FNO/c10-8-4-6(12)5-9-7(8)2-1-3-11-9/h1-5,12H |
| InChIKey | FCDFOVODVHBXTF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=C2F)O)N=C1 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |