For research use only. Not for therapeutic Use.
5-Fluoro-DL-tryptophan (Cat No.: M071430) is a synthetic, racemic analog of the amino acid tryptophan, featuring a fluorine atom substituted at the 5-position of the indole ring. This compound is used in biochemical and pharmaceutical research to study protein structure, enzyme mechanisms, and metabolic pathways involving tryptophan. The fluorine substitution alters electronic and steric properties, making it a valuable probe in NMR spectroscopy and fluorine-labeling studies. 5-Fluoro-DL-tryptophan also helps investigate serotonin biosynthesis and tryptophan transport and metabolism in biological systems.
| CAS Number | 154-08-5 |
| Molecular Formula | C11H11FN2O2 |
| Purity | ≥95% |
| Storage | -20 ℃ |
| IUPAC Name | 2-amino-3-(5-fluoro-1H-indol-3-yl)propanoic acid |
| InChI | InChI=1S/C11H11FN2O2/c12-7-1-2-10-8(4-7)6(5-14-10)3-9(13)11(15)16/h1-2,4-5,9,14H,3,13H2,(H,15,16) |
| InChIKey | INPQIVHQSQUEAJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(=CN2)CC(C(=O)O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
