5-fluoro AMT (hydrochloride) is an analytical reference standard categorized as a tryptamine. This product is intended for research and forensic applications.
| Catalog Number | I020960 |
| CAS Number | 776-56-7 |
| Synonyms | 5-fluoro AMT HCl; 5 fluoro AMT HCl; 5-fluoro α-methyl Tryptamine; 5 fluoro α methyl Tryptamine; α-methyl-5-Fluorotryptamine; α methyl 5 Fluorotryptamine; |
| Molecular Formula | C11H14ClFN2 |
| Purity | 98 |
| Solubility | Soluble in DMSO |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 1-(5-fluoro-1H-indol-3-yl)propan-2-amine hydrochloride |
| InChI | InChI=1S/C11H13FN2.ClH/c1-7(13)4-8-6-14-11-3-2-9(12)5-10(8)11;/h2-3,5-7,14H,4,13H2,1H3;1H |
| InChIKey | RVHBLKWBRZWGLS-UHFFFAOYSA-N |
| SMILES | FC1=CC2=C(C=C1)NC=C2CC(C)N.Cl |
