For research use only. Not for therapeutic Use.
5-Fluoro-2-methylphenyl isocyanate(Cat No.:L007125), is a chemical compound with the molecular formula C8H6FNO. It consists of a phenyl ring substituted with a fluoro atom at the 5th position, a methyl group at the 2nd position, and an isocyanate group (N=C=O) attached. Isocyanates are highly reactive compounds used in various industrial applications, primarily in the production of polyurethane materials. 5-Fluoro-2-methylphenyl isocyanate is a valuable building block in organic synthesis, playing a crucial role in the creation of specialized chemicals and pharmaceutical intermediates, contributing significantly to the field of chemical research and development.
| CAS Number | 67191-93-9 |
| Molecular Formula | C8H6FNO |
| Purity | ≥95% |
| Storage | 2-8°C |
| IUPAC Name | 4-fluoro-2-isocyanato-1-methylbenzene |
| InChI | InChI=1S/C8H6FNO/c1-6-2-3-7(9)4-8(6)10-5-11/h2-4H,1H3 |
| InChIKey | KRAMFLATTKXGOW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)F)N=C=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |