For research use only. Not for therapeutic Use.
5-Fluoro-2-methylaniline is an aromatic amine widely used in pharmaceutical and chemical synthesis. It features a fluorine atom at the 5-position and a methyl group at the 2-position of the aniline ring, offering unique reactivity for the development of bioactive molecules. This compound serves as a valuable intermediate in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals, particularly in the creation of fluorinated compounds known for enhanced stability and bioavailability. Researchers utilize 5-Fluoro-2-methylaniline in drug discovery and development, leveraging its structural properties to design new therapeutic agents and explore innovative chemical pathways.
| CAS Number | 367-29-3 |
| Synonyms | 5-Fluoro-o-toluidine |
| Molecular Formula | C7H8FN |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | 5-fluoro-2-methylaniline |
| InChI | InChI=1S/C7H8FN/c1-5-2-3-6(8)4-7(5)9/h2-4H,9H2,1H3 |
| InChIKey | JLCDTNNLXUMYFQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)F)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |