For research use only. Not for therapeutic Use.
5-Ethylpiperidine-2,4-dione(Cat No.:L013805), is a chemical compound with applications in organic synthesis and pharmaceutical research. It is a piperidine derivative with a keto group at positions 2 and 4 of the piperidine ring. This compound may be used as a building block in the synthesis of various organic molecules, and its unique structure makes it valuable in drug development and medicinal chemistry research.
| CAS Number | 73290-32-1 |
| Molecular Formula | C7H11NO2 |
| Purity | ≥95% |
| Storage | 2-8°C |
| IUPAC Name | 5-ethylpiperidine-2,4-dione |
| InChI | InChI=1S/C7H11NO2/c1-2-5-4-8-7(10)3-6(5)9/h5H,2-4H2,1H3,(H,8,10) |
| InChIKey | BIPNFYPMYSWIGH-UHFFFAOYSA-N |
| SMILES | CCC1CNC(=O)CC1=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |