For research use only. Not for therapeutic Use.
5-Desmethylsinensetin(Cat No.:I044898)is a polymethoxylated flavone derived from citrus peels and other plant sources, structurally related to sinensetin but lacking a methyl group at the 5-position. This slight structural variation enhances certain biological interactions while retaining the core flavone scaffold. 5-Desmethylsinensetin exhibits notable antioxidant, anti-inflammatory, and anticancer activities. It modulates key signaling pathways such as NF-κB, MAPK, and PI3K/Akt, contributing to its effects on inflammation and tumor suppression. Due to its bioactivity and natural origin, it is under investigation for use in functional foods, nutraceuticals, and therapeutic formulations targeting chronic diseases.
| CAS Number | 21763-80-4 |
| Synonyms | 2-(3,4-dimethoxyphenyl)-5-hydroxy-6,7-dimethoxychromen-4-one |
| Molecular Formula | C19H18O7 |
| Purity | ≥95% |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5-hydroxy-6,7-dimethoxychromen-4-one |
| InChI | InChI=1S/C19H18O7/c1-22-12-6-5-10(7-14(12)23-2)13-8-11(20)17-15(26-13)9-16(24-3)19(25-4)18(17)21/h5-9,21H,1-4H3 |
| InChIKey | QEWSAPKRFOFQIU-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC(=O)C3=C(C(=C(C=C3O2)OC)OC)O)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |