5-Dehydroepisterol(CAT: R021920) is a naturally occurring steroidal compound derived from cholesterol metabolism. Its mode of action involves being a metabolite in the biosynthesis of various sterols, including ergosterol in fungi and phytosterols in plants. This compound has biological importance as an intermediate in the formation of essential membrane components and steroid hormones in living organisms. Researchers may study 5-Dehydroepisterol to better understand the biochemical pathways related to sterol metabolism and its potential implications in health and disease.
Catalog Number | R021920 |
CAS Number | 23582-83-4 |
Synonyms | Ergosta-5,7,24(28)-trien-3beta-ol; Campesta-7,24(28)-dien-3β-ol; |
Molecular Formula | C28H44O |
Purity | 95% |
Storage | 2°C to 8°C |
IUPAC Name | (3S,9S,10R,13R,14R,17R)-10,13-dimethyl-17-[(2R)-6-methyl-5-methylideneheptan-2-yl]-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
InChI | InChI=1S/C28H44O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h9-10,18,20,22,24-26,29H,3,7-8,11-17H2,1-2,4-6H3/t20-,22+,24-,25+,26+,27+,28-/m1/s1 |
InChIKey | ZEPNVCGPJXYABB-LOIOQLKMSA-N |
SMILES | CC(C)C(=C)CCC(C)C1CCC2C1(CCC3C2=CC=C4C3(CCC(C4)O)C)C |