For research use only. Not for therapeutic Use.
5-Cyclopropylpentanoic acid(Cat No.:L007239), is a chemical compound with a cyclopropyl ring attached to a pentanoic acid moiety. Its molecular formula is C8H14O2. This compound is of interest in organic synthesis and medicinal chemistry research. The presence of the cyclopropyl group adds unique steric and electronic properties, making it valuable for creating diverse organic molecules. Researchers study its derivatives for potential biological activities, making it significant in drug discovery efforts. The compound’s distinctive structure allows for modifications, enabling the development of novel bioactive agents and contributing to advancements in the field of medicinal chemistry.
CAS Number | 5266-60-4 |
Molecular Formula | C8H14O2 |
Purity | ≥95% |
IUPAC Name | 5-cyclopropylpentanoic acid |
InChI | InChI=1S/C8H14O2/c9-8(10)4-2-1-3-7-5-6-7/h7H,1-6H2,(H,9,10) |
InChIKey | GIQHUMQLXXRAHV-UHFFFAOYSA-N |
SMILES | C1CC1CCCCC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |