5-Cyclopropyl-2-ethynylpyridine(Cat.No:L003982) is a significant compound in organic synthesis. Its unique structure, featuring a cyclopropyl and ethynyl group, imparts distinctive reactivity and properties. This compound serves as a valuable building block in the creation of specialized molecules with applications in pharmaceutical and chemical research.
| Catalog Number | L003982 |
| CAS Number | 1824338-70-6 |
| Molecular Formula | C10H9N |
| Purity | 95% |
| IUPAC Name | 5-cyclopropyl-2-ethynylpyridine |
| InChI | InChI=1S/C10H9N/c1-2-10-6-5-9(7-11-10)8-3-4-8/h1,5-8H,3-4H2 |
| InChIKey | QIVZNLGRLIJKKW-UHFFFAOYSA-N |
| SMILES | C#CC1=NC=C(C=C1)C2CC2 |
