For research use only. Not for therapeutic Use.
NNEI (Item No. <span class=/itemid/>15001</span>) is an analog of the potent synthetic cannabinoid JWH 018 (Item No. <span class=/itemid/>10900</span>) which differs by having an amide linker inserted between the naphthalene and ketone groups. 5-<wbr></wbr>chloro NNEI is a derivative of NNEI that has a chloride atom added to the terminal carbon of the pentyl group. The physiological and toxicological properties of this compound are not known. This product is intended for forensic and research applications.
| CAS Number | 1800101-23-8 |
| Synonyms | 5-chloro MN-24 |
| Molecular Formula | C24H23ClN2O |
| Purity | ≥95% |
| Storage | -20°C |
| InChI | InChI=1S/C24H23ClN2O/c25-15-6-1-7-16-27-17-21(20-12-4-5-14-23(20)27)24(28)26-22-13-8-10-18-9-2-3-11-19(18)22/h2-5,8-14,17H,1,6-7,15-16H2,(H,26,28) |
| InChIKey | SAZREAASVMJYTK-UHFFFAOYSA-N |
| SMILES | O=C(C1=CN(CCCCCCl)C2=C1C=CC=C2)NC3=C(C=CC=C4)C4=CC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |