For research use only. Not for therapeutic Use.
5-Chloro-m-salicylic Acid(Cat No.:R040478)is a chlorinated derivative of salicylic acid, known for its anti-inflammatory, analgesic, and antimicrobial properties. Its structure includes a chlorine atom at the 5-position, which enhances its chemical stability and may influence its biological activity. Like other salicylic acid derivatives, it is studied for potential applications in pharmaceuticals, particularly in treating skin conditions such as acne, psoriasis, and other inflammatory disorders. Additionally, its antimicrobial properties make it a candidate for developing topical treatments, and it is useful as an intermediate in chemical synthesis for various industrial applications.
CAS Number | 53984-36-4 |
Synonyms | 3-Chloro-5-hydroxybenzoic Acid; 3-Hydroxy-5-chlorobenzoic Acid |
Molecular Formula | C7H5ClO3 |
Purity | ≥95% |
Target | GPR81 |
Solubility | Soluble in DMSO |
Storage | RT |
IUPAC Name | 3-chloro-5-hydroxybenzoic acid |
InChI | InChI=1S/C7H5ClO3/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,9H,(H,10,11) |
InChIKey | RJOLIYHZZKAIET-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C=C1O)Cl)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |